Difference between revisions of "CHC T00009372001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
(Created page with "Category:Gene == Gene CHC_T00009372001_1 == * Synonym(s): == Reactions associated == * Reaction: ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN ** Source: orthology-galdieria...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene CHC_T00009372001_1 ==
−
* smiles:
+
−
** C=C1(C(CC([N+])C([O-])=O)C1)
+
−
* inchi key:
+
−
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
−
* common name:
+
−
** hypoglycin A
+
−
* molecular weight:
+
−
** 141.169   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine
 
−
** hypoglycine A
 
−
** hypoglycin
 
−
** L-β-(methylenecyclopropyl)-alanine
 
−
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9157]]
+
* Reaction: [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-galdieria.sulphuraria]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-10717]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-1102]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[RXN-1125]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Reaction: [[RXN-12484]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Reaction: [[RXN-14023]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways associated ==
 +
* [[PWY-7178]]
 +
* [[PWY-6307]]
 +
* [[PWY-361]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN|RXN-10717|RXN-1102|RXN-1125|RXN-12484|RXN-14023}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
{{#set: pathway associated=PWY-7178|PWY-6307|PWY-361}}
−
* Wikipedia : Hypoglycin
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
−
* HMDB : HMDB29427
+
−
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
−
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=hypoglycin A}}
+
−
{{#set: molecular weight=141.169    }}
+
−
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
−
{{#set: consumed by=RXN-9157}}
+

Latest revision as of 16:12, 23 May 2018

Gene CHC_T00009372001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009372001_1&oldid=16478"