Difference between revisions of "CHC T00006316001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2742 CPD-2742] == * smiles: ** C1(=O)(CC[CH](N(C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00006316001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[BETA-UREIDOPROPIONASE-RXN]] |
| − | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
| − | * [[ | + | ** Source: [[orthology-arabidopsis_thaliana]] |
| − | + | * Reaction: [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]] | |
| − | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | * Reaction: [[RXN-11210]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | == Pathways associated == | ||
| + | * [[PWY-43]] | ||
| + | * [[PWY-6430]] | ||
| + | * [[PWY-3982]] | ||
| + | * [[ARGDEG-III-PWY]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=BETA-UREIDOPROPIONASE-RXN|N-CARBAMOYLPUTRESCINE-AMIDASE-RXN|RXN-11210}} | |
| − | + | {{#set: pathway associated=PWY-43|PWY-6430|PWY-3982|ARGDEG-III-PWY}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 16:51, 9 January 2019
Gene CHC_T00006316001_1
- Synonym(s):
Reactions associated
- Reaction: BETA-UREIDOPROPIONASE-RXN
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: N-CARBAMOYLPUTRESCINE-AMIDASE-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: RXN-11210
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
