Difference between revisions of "CHC T00008362001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
(Created page with "Category:Gene == Gene CHC_T00008362001 == * left end position: ** 56157 * transcription direction: ** NEGATIVE * right end position: ** 58934 * centisome position: ** 91.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008362001 == |
− | * | + | * left end position: |
− | ** | + | ** 56157 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 58934 |
− | * | + | * centisome position: |
− | ** | + | ** 91.722336 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | * [[ | + | * Reaction: [[RXN0-4961]] |
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=56157}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=58934}} |
− | {{#set: | + | {{#set: centisome position=91.722336 }} |
− | {{#set: | + | {{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN|RXN0-4961}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 17:15, 23 May 2018
Gene CHC_T00008362001
- left end position:
- 56157
- transcription direction:
- NEGATIVE
- right end position:
- 58934
- centisome position:
- 91.722336
- Synonym(s):
Reactions associated
- Reaction: DNA-DIRECTED-DNA-POLYMERASE-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
- Reaction: RXN0-4961
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome