Difference between revisions of "RXN-16165"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * smiles: ** [O-]P(OP(=O)(OP([O-])(=O)[O-])[O-])([O-])=O * inchi key: ** InChIKey=U...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16165 RXN-16165] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** methionine--tRNA ligase, cytoplasmic |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.1.1.10 EC-6.1.1.10] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[Initiation-tRNAmet]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[L-methionyl-tRNAfmet]][c] '''+''' 1 [[AMP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 L-methionine[c] '''+''' 1 initiator tRNAmet[c] '''=>''' 1 diphosphate[c] '''+''' 1 an L-methionyl-[initiator tRNAmet][c] '''+''' 1 AMP[c] |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00006241001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00007020001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00009091001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00009091001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | ||
+ | ** '''21''' reactions found over '''21''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=methionine--tRNA ligase, cytoplasmic}} | |
− | + | {{#set: ec number=EC-6.1.1.10}} | |
− | + | {{#set: gene associated=CHC_T00006241001_1|CHC_T00007020001_1|CHC_T00009091001_1|CHC_T00009091001}} | |
− | + | {{#set: in pathway=TRNA-CHARGING-PWY}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:01, 9 January 2019
Contents
Reaction RXN-16165
- direction:
- LEFT-TO-RIGHT
- common name:
- methionine--tRNA ligase, cytoplasmic
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ATP[c] + 1 MET[c] + 1 Initiation-tRNAmet[c] => 1 PPI[c] + 1 L-methionyl-tRNAfmet[c] + 1 AMP[c]
- With common name(s):
- 1 ATP[c] + 1 L-methionine[c] + 1 initiator tRNAmet[c] => 1 diphosphate[c] + 1 an L-methionyl-[initiator tRNAmet][c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006241001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00007020001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00009091001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00009091001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- TRNA-CHARGING-PWY, tRNA charging: TRNA-CHARGING-PWY
- 21 reactions found over 21 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome