Difference between revisions of "OH-PYR"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOHMETRANS-RXN GLYOHMETRANS-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.exp...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYOHMETRANS-RXN GLYOHMETRANS-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-PYR OH-PYR] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(C(=O)C([O-])=O)O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/2.1.2.1 EC-2.1.2.1]
+
** 103.054   
 +
* inchi key:
 +
** InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M
 +
* common name:
 +
** hydroxypyruvate
 
* Synonym(s):
 
* Synonym(s):
 +
** β-hydroxypyruvate
 +
** OH-pyruvate
 +
** OH-pyr
 +
** 3-hydroxypyruvate
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[GLYCERATE-DEHYDROGENASE-RXN]]
** 1 [[THF-GLU-N]][c] '''+''' 1 [[SER]][c] '''<=>''' 1 [[METHYLENE-THF-GLU-N]][c] '''+''' 1 [[GLY]][c] '''+''' 1 [[WATER]][c]
+
* [[RXN0-300]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 a tetrahydrofolate[c] '''+''' 1 L-serine[c] '''<=>''' 1 a 5,10-methylene-tetrahydrofolate[c] '''+''' 1 glycine[c] '''+''' 1 H2O[c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[HYDROXYPYRUVATE-REDUCTASE-RXN]]
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00008323001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00009460001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
* [[PWY-2161]], folate polyglutamylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2161 PWY-2161]
+
** '''5''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-181]], photorespiration: [http://metacyc.org/META/NEW-IMAGE?object=PWY-181 PWY-181]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-3841]], folate transformations II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841]
+
** '''7''' reactions found over '''11''' reactions in the full pathway
+
* [[1CMET2-PWY]], N10-formyl-tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=1CMET2-PWY 1CMET2-PWY]
+
** '''6''' reactions found over '''9''' reactions in the full pathway
+
* [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
+
** '''4''' reactions found over '''7''' reactions in the full pathway
+
* [[GLYSYN-PWY]], glycine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=GLYSYN-PWY GLYSYN-PWY]
+
** '''1''' reactions found over '''1''' reactions in the full pathway
+
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
** '''7''' reactions found over '''24''' reactions in the full pathway
+
* [[PWY-2201]], folate transformations I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2201 PWY-2201]
+
** '''5''' reactions found over '''12''' reactions in the full pathway
+
* [[PWY-1622]], formaldehyde assimilation I (serine pathway): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1622 PWY-1622]
+
** '''6''' reactions found over '''13''' reactions in the full pathway
+
* [[PWY-3661-1]], glycine betaine degradation II (mammalian): [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661-1 PWY-3661-1]
+
** '''1''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* METABOLIGHTS : MTBLC17180
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15481 15481]
+
* BIGG : hpyr
* LIGAND-RXN:
+
* CAS : 1113-60-6
** [http://www.genome.jp/dbget-bin/www_bget?R00945 R00945]
+
* HMDB : HMDB01352
* UNIPROT:
+
* CHEMSPIDER:
** [http://www.uniprot.org/uniprot/P35623 P35623]
+
** [http://www.chemspider.com/Chemical-Structure.3397158.html 3397158]
** [http://www.uniprot.org/uniprot/P34898 P34898]
+
* CHEBI:
** [http://www.uniprot.org/uniprot/P34899 P34899]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17180 17180]
** [http://www.uniprot.org/uniprot/P34896 P34896]
+
* LIGAND-CPD:
** [http://www.uniprot.org/uniprot/Q9CHW7 Q9CHW7]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00168 C00168]
** [http://www.uniprot.org/uniprot/P34897 P34897]
+
* PUBCHEM:
** [http://www.uniprot.org/uniprot/P0A2E1 P0A2E1]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4186339 4186339]
** [http://www.uniprot.org/uniprot/O23254 O23254]
+
{{#set: smiles=C(C(=O)C([O-])=O)O}}
** [http://www.uniprot.org/uniprot/O53441 O53441]
+
{{#set: molecular weight=103.054    }}
** [http://www.uniprot.org/uniprot/O08370 O08370]
+
{{#set: inchi key=InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M}}
** [http://www.uniprot.org/uniprot/P43844 P43844]
+
{{#set: common name=hydroxypyruvate}}
** [http://www.uniprot.org/uniprot/Q58992 Q58992]
+
{{#set: common name=&beta;-hydroxypyruvate|OH-pyruvate|OH-pyr|3-hydroxypyruvate}}
** [http://www.uniprot.org/uniprot/O66776 O66776]
+
{{#set: consumed by=GLYCERATE-DEHYDROGENASE-RXN|RXN0-300}}
** [http://www.uniprot.org/uniprot/Q9XAY7 Q9XAY7]
+
{{#set: reversible reaction associated=HYDROXYPYRUVATE-REDUCTASE-RXN}}
** [http://www.uniprot.org/uniprot/P47634 P47634]
+
** [http://www.uniprot.org/uniprot/Q9WZH9 Q9WZH9]
+
** [http://www.uniprot.org/uniprot/P56089 P56089]
+
** [http://www.uniprot.org/uniprot/O53615 O53615]
+
** [http://www.uniprot.org/uniprot/O83349 O83349]
+
** [http://www.uniprot.org/uniprot/Q9ZMP7 Q9ZMP7]
+
** [http://www.uniprot.org/uniprot/O51547 O51547]
+
** [http://www.uniprot.org/uniprot/O84439 O84439]
+
** [http://www.uniprot.org/uniprot/P24531 P24531]
+
** [http://www.uniprot.org/uniprot/P39148 P39148]
+
** [http://www.uniprot.org/uniprot/P24060 P24060]
+
** [http://www.uniprot.org/uniprot/P37292 P37292]
+
** [http://www.uniprot.org/uniprot/P34895 P34895]
+
** [http://www.uniprot.org/uniprot/P34894 P34894]
+
** [http://www.uniprot.org/uniprot/P49357 P49357]
+
** [http://www.uniprot.org/uniprot/P49358 P49358]
+
** [http://www.uniprot.org/uniprot/P50433 P50433]
+
** [http://www.uniprot.org/uniprot/P37291 P37291]
+
** [http://www.uniprot.org/uniprot/P78011 P78011]
+
** [http://www.uniprot.org/uniprot/P77962 P77962]
+
** [http://www.uniprot.org/uniprot/Q9SVM4 Q9SVM4]
+
** [http://www.uniprot.org/uniprot/Q9SUU0 Q9SUU0]
+
** [http://www.uniprot.org/uniprot/Q9SZJ5 Q9SZJ5]
+
** [http://www.uniprot.org/uniprot/O23984 O23984]
+
** [http://www.uniprot.org/uniprot/P0A825 P0A825]
+
** [http://www.uniprot.org/uniprot/P07511 P07511]
+
{{#set: direction=REVERSIBLE}}
+
{{#set: ec number=EC-2.1.2.1}}
+
{{#set: gene associated=CHC_T00008323001_1|CHC_T00009460001_1}}
+
{{#set: in pathway=PWY-2161|PWY-181|PWY-3841|1CMET2-PWY|PWY-3661|GLYSYN-PWY|PWY-5497|PWY-2201|PWY-1622|PWY-3661-1}}
+
{{#set: reconstruction category=orthology}}
+
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Latest revision as of 17:06, 9 January 2019

Metabolite OH-PYR

  • smiles:
    • C(C(=O)C([O-])=O)O
  • molecular weight:
    • 103.054
  • inchi key:
    • InChIKey=HHDDCCUIIUWNGJ-UHFFFAOYSA-M
  • common name:
    • hydroxypyruvate
  • Synonym(s):
    • β-hydroxypyruvate
    • OH-pyruvate
    • OH-pyr
    • 3-hydroxypyruvate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • METABOLIGHTS : MTBLC17180
  • BIGG : hpyr
  • CAS : 1113-60-6
  • HMDB : HMDB01352
  • CHEMSPIDER:
  • CHEBI:
  • LIGAND-CPD:
  • PUBCHEM:
"C(C(=O)C([O-])=O)O" cannot be used as a page name in this wiki.