Difference between revisions of "CPD-14704"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.4-RXN 3.6.3.4-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.6.3.4-RXN 3.6.3.4-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/3.6.3.4 EC-3.6.3.4]
+
** 462.537   
 +
* inchi key:
 +
** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
 +
* common name:
 +
** 4-hydroxy-2-nonenal-glutathione conjugate
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CU+2]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CU+2]][e] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c]
+
* [[RXN-13673]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 Cu2+[c] '''+''' 1 ATP[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 Cu2+[e] '''+''' 1 H+[c] '''+''' 1 ADP[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[CHC_T00005829001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00000800001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00004889001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[CHC_T00004800001_1]]
+
** [[pantograph]]-[[galdieria.sulphuraria]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* [[orthology]]:
+
** [[pantograph]]:
+
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
* RHEA:
+
* PUBCHEM:
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10376 10376]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
{{#set: ec number=EC-3.6.3.4}}
+
{{#set: molecular weight=462.537    }}
{{#set: gene associated=CHC_T00005829001_1|CHC_T00000800001_1|CHC_T00004889001_1|CHC_T00004800001_1}}
+
{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
{{#set: in pathway=}}
+
{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-13673}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: reconstruction source=galdieria.sulphuraria}}
+

Latest revision as of 17:07, 9 January 2019

Metabolite CPD-14704

  • smiles:
    • CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
  • molecular weight:
    • 462.537
  • inchi key:
    • InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
  • common name:
    • 4-hydroxy-2-nonenal-glutathione conjugate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.