Difference between revisions of "5-OXOPROLINASE-ATP-HYDROLYSING-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * inchi key: ** InChIKey...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINASE-ATP-HYDROLYSING-RXN 5-OXOPROLINASE-ATP-HYDROLYSING-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 5-oxo-L-prolinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.2.9 EC-3.5.2.9] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[5-OXOPROLINE]][c] '''+''' 1 [[ATP]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[GLT]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 5-oxo-L-proline[c] '''+''' 1 ATP[c] '''+''' 2 H2O[c] '''=>''' 1 L-glutamate[c] '''+''' 1 phosphate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008487001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Gene: [[CHC_T00008487001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10348 10348] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P97608 P97608] |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00251 R00251] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=5-oxo-L-prolinase}} |
− | + | {{#set: ec number=EC-3.5.2.9}} | |
− | {{#set: | + | {{#set: gene associated=CHC_T00008487001_1|CHC_T00008487001}} |
− | {{#set: | + | {{#set: in pathway=PWY-4041}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-arabidopsis_thaliana|orthology-ectocarpus_siliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:04, 9 January 2019
Contents
Reaction 5-OXOPROLINASE-ATP-HYDROLYSING-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 5-oxo-L-prolinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 5-oxo-L-proline[c] + 1 ATP[c] + 2 H2O[c] => 1 L-glutamate[c] + 1 phosphate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008487001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Gene: CHC_T00008487001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links