Difference between revisions of "CPD-11497"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008744001_1 == * Synonym(s): == Reactions associated == * GLYCEROL-KIN-RXN ** pantograph-galdieria.sulphuraria ** pantograph-...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == |
| + | * smiles: | ||
| + | ** COC1(=C(O)C=CC(C(O)CO)=C1) | ||
| + | * molecular weight: | ||
| + | ** 184.191 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N | ||
| + | * common name: | ||
| + | ** 3-methoxy-4-hydroxyphenylglycol | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** methoxyhydroxyphenylglycol | ||
| + | ** vanylglycol | ||
| + | ** MHPG piperazine | ||
| + | ** MHPG | ||
| + | ** MOPEG | ||
| + | ** methoxy-hydroxyphenyl glycol | ||
| + | ** 4-hydroxy-3-methoxyphenylglycol | ||
| + | ** hydroxymethoxyphenylglycol | ||
| + | ** HMPG | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-10915]] | |
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=688030 688030] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05594 C05594] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10348.html 10348] | ||
| + | * HMDB : HMDB01490 | ||
| + | {{#set: smiles=COC1(=C(O)C=CC(C(O)CO)=C1)}} | ||
| + | {{#set: molecular weight=184.191 }} | ||
| + | {{#set: inchi key=InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N}} | ||
| + | {{#set: common name=3-methoxy-4-hydroxyphenylglycol}} | ||
| + | {{#set: common name=methoxyhydroxyphenylglycol|vanylglycol|MHPG piperazine|MHPG|MOPEG|methoxy-hydroxyphenyl glycol|4-hydroxy-3-methoxyphenylglycol|hydroxymethoxyphenylglycol|HMPG}} | ||
| + | {{#set: reversible reaction associated=RXN-10915}} | ||
Latest revision as of 17:08, 9 January 2019
Contents
Metabolite CPD-11497
- smiles:
- COC1(=C(O)C=CC(C(O)CO)=C1)
- molecular weight:
- 184.191
- inchi key:
- InChIKey=FBWPWWWZWKPJFL-QMMMGPOBSA-N
- common name:
- 3-methoxy-4-hydroxyphenylglycol
- Synonym(s):
- methoxyhydroxyphenylglycol
- vanylglycol
- MHPG piperazine
- MHPG
- MOPEG
- methoxy-hydroxyphenyl glycol
- 4-hydroxy-3-methoxyphenylglycol
- hydroxymethoxyphenylglycol
- HMPG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
