Difference between revisions of "RXN-16117"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12568 CPD-12568] == * smiles: ** C=CC(CCC=C(CCC=C(C)C)C)(C)O * common name: ** (3S,6E)-nero...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12568 CPD-12568] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16117 RXN-16117] ==
−
* smiles:
+
* direction:
−
** C=CC(CCC=C(CCC=C(C)C)C)(C)O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (3S,6E)-nerolidol
+
** glycerol-3-phosphate acyltransferase
−
* inchi key:
+
* ec number:
−
** InChIKey=FQTLCLSUCSAZDY-ATGUSINASA-N
+
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
−
* molecular weight:
+
−
** 222.37   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (3S)-(E)-nerolidol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11911]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17370]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[CPD-17372]][c] '''+''' 1 [[CO-A]][c]
−
* [[RXN-8616]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 18-hydroxyoleoyl-CoA[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 1-[18-hydroxyoleyl]-2-lyso-phosphatidate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008773001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008773001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6453]], stigma estolide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6453 PWY-6453]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0103010005
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=glycerol-3-phosphate acyltransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281525 5281525]
+
{{#set: ec number=EC-2.3.1.15}}
−
* KNAPSACK : C00003166
+
{{#set: gene associated=CHC_T00008773001|CHC_T00008773001_1}}
−
* HMDB : HMDB41629
+
{{#set: in pathway=PWY-6453}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09704 C09704]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.4444858.html 4444858]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59958 59958]
+
−
{{#set: smiles=C=CC(CCC=C(CCC=C(C)C)C)(C)O}}
+
−
{{#set: common name=(3S,6E)-nerolidol}}
+
−
{{#set: inchi key=InChIKey=FQTLCLSUCSAZDY-ATGUSINASA-N}}
+
−
{{#set: molecular weight=222.37    }}
+
−
{{#set: common name=(3S)-(E)-nerolidol}}
+
−
{{#set: consumed by=RXN-11911}}
+
−
{{#set: produced by=RXN-8616}}
+

Latest revision as of 17:05, 9 January 2019

Reaction RXN-16117

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glycerol-3-phosphate acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 18-hydroxyoleoyl-CoA[c] + 1 sn-glycerol 3-phosphate[c] => 1 1-[18-hydroxyoleyl]-2-lyso-phosphatidate[c] + 1 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6453, stigma estolide biosynthesis: PWY-6453
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-16117&oldid=22687"