Difference between revisions of "CHC T00009387001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009387001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[6PFRUCTPHOS-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | == Pathways associated == | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-1042]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[PWY-7385]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[PWY-1861]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=6PFRUCTPHOS-RXN}} | |
− | + | {{#set: pathway associated=GLYCOLYSIS|PWY-1042|PWY-5484|PWY-7385|ANAGLYCOLYSIS-PWY|PWY-1861}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:00, 9 January 2019
Gene CHC_T00009387001_1
- Synonym(s):
Reactions associated
- Reaction: 6PFRUCTPHOS-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Source: orthology-arabidopsis_thaliana