Difference between revisions of "CPD-15688"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11270 RXN-11270] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * molecular weight: | ||
+ | ** 941.776 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J | ||
+ | * common name: | ||
+ | ** 3-cis, 5-trans-dodecadienoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14799]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657300 90657300] |
− | {{#set: | + | {{#set: smiles=CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: molecular weight=941.776 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J}} |
+ | {{#set: common name=3-cis, 5-trans-dodecadienoyl-CoA}} | ||
+ | {{#set: produced by=RXN-14799}} |
Latest revision as of 17:09, 9 January 2019
Contents
Metabolite CPD-15688
- smiles:
- CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 941.776
- inchi key:
- InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
- common name:
- 3-cis, 5-trans-dodecadienoyl-CoA
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.