Difference between revisions of "CPD-15688"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11270 RXN-11270] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11270 RXN-11270] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15688 CPD-15688] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 941.776   
 +
* inchi key:
 +
** InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
 +
* common name:
 +
** 3-cis, 5-trans-dodecadienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-12218]][c] '''=>''' 1 [[ACET]][c] '''+''' 1 [[BENZALDEHYDE]][c]
+
* [[RXN-14799]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 3-hydroxy-3-phenylpropanoate[c] '''=>''' 1 acetate[c] '''+''' 1 benzaldehyde[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-6444]], benzoate biosynthesis II (CoA-independent, non-β-oxidative): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6444 PWY-6444]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[gap-filling]]:
+
** [[meneco]]:
+
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: in pathway=PWY-6444}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657300 90657300]
{{#set: reconstruction category=gap-filling}}
+
{{#set: smiles=CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: reconstruction tool=meneco}}
+
{{#set: molecular weight=941.776    }}
{{#set: reconstruction source=added for gapfilling}}
+
{{#set: inchi key=InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J}}
 +
{{#set: common name=3-cis, 5-trans-dodecadienoyl-CoA}}
 +
{{#set: produced by=RXN-14799}}

Latest revision as of 17:09, 9 January 2019

Metabolite CPD-15688

  • smiles:
    • CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 941.776
  • inchi key:
    • InChIKey=ARQUZFJQPYWSSL-NBLUIMTHSA-J
  • common name:
    • 3-cis, 5-trans-dodecadienoyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CC=CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.