Difference between revisions of "RXN-12507"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] == * smiles: ** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12507 RXN-12507] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19150 CPD-19150] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12507 RXN-12507] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J
+
−
* common name:
+
−
** (2E,5Z)-dodecenoyl-CoA
+
−
* molecular weight:
+
−
** 941.776   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 12:2-Δ2,Δ5-CoA
 
−
** 2-trans,5-cis-dodecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17797]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD0-2171]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-10284]][c] '''+''' 1 [[NADH]][c]
−
* [[RXN-17796]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 (S)-3-hydroxytetradecanoyl-CoA[c] '''=>''' 1 H+[c] '''+''' 1 3-oxo-myristoyl-CoA[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009349001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
* Gene: [[CHC_T00008882001_1]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''5''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* RHEA:
−
{{#set: inchi key=InChIKey=ZSJRXHRCABOSNC-SHJPOGNXSA-J}}
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31168 31168]
−
{{#set: common name=(2E,5Z)-dodecenoyl-CoA}}
+
* LIGAND-RXN:
−
{{#set: molecular weight=941.776    }}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04739 R04739]
−
{{#set: common name=12:2-Δ2,Δ5-CoA|2-trans,5-cis-dodecenoyl-CoA}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: consumed by=RXN-17797}}
+
{{#set: gene associated=CHC_T00009349001_1|CHC_T00008882001_1}}
−
{{#set: produced by=RXN-17796}}
+
{{#set: in pathway=PWY-7654}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-arabidopsis_thaliana}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 16:21, 23 May 2018

Reaction RXN-12507

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 (S)-3-hydroxytetradecanoyl-CoA[c] => 1 H+[c] + 1 3-oxo-myristoyl-CoA[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 5 reactions found over 11 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-12507&oldid=16891"