Difference between revisions of "FORMYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] == * smiles: ** C(SSCC(C(NCC([O-])=O)=O)NC(=O)CCC([N...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FORMYL-COA FORMYL-COA] == |
* smiles: | * smiles: | ||
| − | ** C | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
| + | * molecular weight: | ||
| + | ** 791.513 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J |
* common name: | * common name: | ||
| − | ** | + | ** formyl-CoA |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * METABOLIGHTS : | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57376 57376] |
| + | * METABOLIGHTS : MTBLC57376 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266602 45266602] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00798 C00798] |
| − | * | + | * HMDB : HMDB03419 |
| − | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: molecular weight=791.513 }} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J}} |
| − | + | {{#set: common name=formyl-CoA}} | |
| − | + | {{#set: produced by=RXN66-475-CPD-14717//CPD-14719/FORMYL-COA.32.}} | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: produced by= | + | |
Latest revision as of 17:10, 9 January 2019
Contents
Metabolite FORMYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 791.513
- inchi key:
- InChIKey=SXMOKYXNAPLNCW-GORZOVPNSA-J
- common name:
- formyl-CoA
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCS[CH]=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
