Difference between revisions of "CPD-17372"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COB-I-ALAMIN COB-I-ALAMIN] == * smiles: ** CC%10(=C(C)C=C9(N8(C%12(OC(CO)C(OP([O-])(=O)OC(C)CNC...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17372 CPD-17372] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O |
+ | * molecular weight: | ||
+ | ** 450.508 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L |
* common name: | * common name: | ||
− | ** | + | ** 1-[18-hydroxyoleyl]-2-lyso-phosphatidate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16118]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16117]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820233 91820233] |
− | + | {{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O}} | |
− | + | {{#set: molecular weight=450.508 }} | |
− | + | {{#set: inchi key=InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L}} | |
− | + | {{#set: common name=1-[18-hydroxyoleyl]-2-lyso-phosphatidate}} | |
− | + | {{#set: consumed by=RXN-16118}} | |
− | + | {{#set: produced by=RXN-16117}} | |
− | + | ||
− | + | ||
− | {{#set: smiles | + | |
− | + | ||
− | + | ||
− | {{#set: molecular weight= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:11, 9 January 2019
Contents
Metabolite CPD-17372
- smiles:
- C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O
- molecular weight:
- 450.508
- inchi key:
- InChIKey=GFJKJLHWWZXDAU-KXFGNQBASA-L
- common name:
- 1-[18-hydroxyoleyl]-2-lyso-phosphatidate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(O)CCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoleyl]-2-lyso-phosphatidate" cannot be used as a page name in this wiki.