Difference between revisions of "CPD-8291"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNARA-8002 RXNARA-8002] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** prephytoene-diphosphate...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXNARA-8002 RXNARA-8002] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8291 CPD-8291] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
 +
* molecular weight:
 +
** 744.043   
 +
* inchi key:
 +
** InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
 +
* common name:
 +
** 1-18:1-2-18:1-phosphatidylethanolamine
 
* Synonym(s):
 
* Synonym(s):
** prephytoene-diphosphate synthase
+
** phosphatidylethanolamine (1-18:1-2-18:1)
** PSase
+
** 18:1-18:1-PE
** geranylgeranyl-diphosphate geranylgeranyltransferase
+
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[CPD-464]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[CPD-12321]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-15036]]
** 1 prephytoene diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 15-cis-phytoene[c]
+
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-6287]], neurosporene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6287 PWY-6287]
+
** '''2''' reactions found over '''5''' reactions in the full pathway
+
* [[PWY-5942]], trans-lycopene biosynthesis I (bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5942 PWY-5942]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[PWY-6475]], trans-lycopene biosynthesis II (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6475 PWY-6475]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* CHEBI:
** [http://www.genome.jp/dbget-bin/www_bget?R07270 R07270]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74986 74986]
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=prephytoene-diphosphate synthase|PSase|geranylgeranyl-diphosphate geranylgeranyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44251425 44251425]
{{#set: in pathway=PWY-6287|PWY-5942|PWY-6475}}
+
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O}}
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=744.043    }}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N}}
{{#set: reconstruction source=original_genome}}
+
{{#set: common name=1-18:1-2-18:1-phosphatidylethanolamine}}
 +
{{#set: common name=phosphatidylethanolamine (1-18:1-2-18:1)|18:1-18:1-PE|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine}}
 +
{{#set: reversible reaction associated=RXN-15036}}

Latest revision as of 18:11, 9 January 2019

Metabolite CPD-8291

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O
  • molecular weight:
    • 744.043
  • inchi key:
    • InChIKey=MWRBNPKJOOWZPW-NYVOMTAGSA-N
  • common name:
    • 1-18:1-2-18:1-phosphatidylethanolamine
  • Synonym(s):
    • phosphatidylethanolamine (1-18:1-2-18:1)
    • 18:1-18:1-PE
    • 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphoethanolamine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP(OCC[N+])([O-])=O)=O" cannot be used as a page name in this wiki.