Difference between revisions of "MG-PROTOPORPHYRIN-MONOMETHYL-ESTER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA-TOCOPHEROL DELTA-TOCOPHEROL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=CC(=...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN-MONOMETHYL-ESTER MG-PROTOPORPHYRIN-MONOMETHYL-ESTER] == |
* smiles: | * smiles: | ||
− | ** | + | ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8)))) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 597.975 |
+ | * common name: | ||
+ | ** magnesium-protoporphyrin IX 13-monomethyl ester | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Mg-protoporphyrin monomethyl ester |
+ | ** magnesium protoporphyrin monomethyl ester | ||
+ | ** MgPMME | ||
+ | ** magnesium-protoporphyrin IX 13-methyl ester | ||
+ | ** MgP monomethyl ester | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-5282]] |
+ | * [[RXN-13191]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60491 60491] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657954 90657954] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04536 C04536] |
− | + | {{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))}} | |
− | + | {{#set: molecular weight=597.975 }} | |
− | + | {{#set: common name=magnesium-protoporphyrin IX 13-monomethyl ester}} | |
− | + | {{#set: common name=Mg-protoporphyrin monomethyl ester|magnesium protoporphyrin monomethyl ester|MgPMME|magnesium-protoporphyrin IX 13-methyl ester|MgP monomethyl ester}} | |
− | + | {{#set: consumed by=RXN-5282|RXN-13191}} | |
− | {{#set: smiles= | + | {{#set: produced by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:11, 9 January 2019
Contents
Metabolite MG-PROTOPORPHYRIN-MONOMETHYL-ESTER
- smiles:
- C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))
- molecular weight:
- 597.975
- common name:
- magnesium-protoporphyrin IX 13-monomethyl ester
- Synonym(s):
- Mg-protoporphyrin monomethyl ester
- magnesium protoporphyrin monomethyl ester
- MgPMME
- magnesium-protoporphyrin IX 13-methyl ester
- MgP monomethyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.