Difference between revisions of "CPD-15382"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CYSTEINE-AMINOTRANSFERASE-RXN CYSTEINE-AMINOTRANSFERASE-RXN] == * direction: ** REVERSIBLE * ec num...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15382 CPD-15382] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(=O)C(O)C(O)C(O)CO |
− | * | + | * molecular weight: |
− | ** | + | ** 180.157 |
+ | * inchi key: | ||
+ | ** InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N | ||
+ | * common name: | ||
+ | ** keto-D-fructose | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-7644]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48095 48095] |
− | * | + | * METABOLIGHTS : MTBLC48095 |
− | ** [http:// | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5984 5984] |
− | {{#set: | + | {{#set: smiles=C(O)C(=O)C(O)C(O)C(O)CO}} |
− | {{#set: | + | {{#set: molecular weight=180.157 }} |
− | + | {{#set: inchi key=InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N}} | |
− | {{#set: | + | {{#set: common name=keto-D-fructose}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-7644}} |
− | + |
Latest revision as of 17:12, 9 January 2019
Contents
Metabolite CPD-15382
- smiles:
- C(O)C(=O)C(O)C(O)C(O)CO
- molecular weight:
- 180.157
- inchi key:
- InChIKey=BJHIKXHVCXFQLS-UYFOZJQFSA-N
- common name:
- keto-D-fructose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links