Difference between revisions of "CHC T00007059001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * inchi key: *...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00007059001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | * [[RXN- | + | ** Source: [[orthology-arabidopsis_thaliana]] |
− | == | + | * Reaction: [[H2PTEROATESYNTH-RXN]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Reaction: [[RXN-15733]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7539]] | ||
+ | * [[PWY-6148]] | ||
+ | * [[PWY-6797]] | ||
+ | * [[PWY-6147]] | ||
+ | * [[PWY-6614]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=H2PTERIDINEPYROPHOSPHOKIN-RXN|H2PTEROATESYNTH-RXN|RXN-15733}} | |
− | + | {{#set: pathway associated=PWY-7539|PWY-6148|PWY-6797|PWY-6147|PWY-6614}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 18:04, 9 January 2019
Gene CHC_T00007059001_1
- Synonym(s):
Reactions associated
- Reaction: H2PTERIDINEPYROPHOSPHOKIN-RXN
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: H2PTEROATESYNTH-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: RXN-15733
- Source: orthology-ectocarpus_siliculosus