Difference between revisions of "L-DEHYDRO-ASCORBATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE PHOSPHORIBOSYL-CARBOXY-AMINOIMIDAZOLE] == * smiles: ** C(...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) |
+ | * molecular weight: | ||
+ | ** 174.11 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N |
* common name: | * common name: | ||
− | ** | + | ** L-dehydro-ascorbate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dehydroascorbate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[1.8.5.1-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12440]] |
+ | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070] | ||
+ | * METABOLIGHTS : MTBLC58070 | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810] |
− | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05422 C05422] |
− | * | + | * HMDB : HMDB01264 |
− | + | {{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}} | |
− | + | {{#set: molecular weight=174.11 }} | |
− | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=L-dehydro-ascorbate}} |
− | {{#set: common name= | + | {{#set: common name=dehydroascorbate}} |
− | + | {{#set: consumed by=1.8.5.1-RXN}} | |
− | {{#set: common name= | + | {{#set: produced by=RXN-12440|DOPAMINE-BETA-MONOOXYGENASE-RXN}} |
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Latest revision as of 17:13, 9 January 2019
Contents
Metabolite L-DEHYDRO-ASCORBATE
- smiles:
- C(O)C(O)C1(C(=O)C(=O)C(=O)O1)
- molecular weight:
- 174.11
- inchi key:
- InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N
- common name:
- L-dehydro-ascorbate
- Synonym(s):
- dehydroascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links