Difference between revisions of "CPD-15301"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8976 RXN-8976] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15301 CPD-15301] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2)) |
− | * | + | * molecular weight: |
− | ** | + | ** 633.085 |
+ | * inchi key: | ||
+ | ** InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** caldariellaquinol | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15378]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/ | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73388 73388] |
− | * LIGAND- | + | * METABOLIGHTS : MTBLC73388 |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464569 71464569] |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C20623 C20623] |
− | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))}} |
− | {{#set: | + | {{#set: molecular weight=633.085 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N}} |
− | + | {{#set: common name=caldariellaquinol}} | |
+ | {{#set: produced by=RXN-15378}} |
Latest revision as of 17:13, 9 January 2019
Contents
Metabolite CPD-15301
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCCC(C)CCC2(C(SC)=C(O)C1(=C(SC=C1)C(O)=2))
- molecular weight:
- 633.085
- inchi key:
- InChIKey=UVCQOKDZGIAHDG-UHFFFAOYSA-N
- common name:
- caldariellaquinol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links