Difference between revisions of "CHC T00000990001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
 
(Created page with "Category:Gene == Gene CHC_T00000990001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN1F-20 ** Source: orthology-ectocarpus_siliculosus == Pathways...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
+
== Gene CHC_T00000990001_1 ==
* smiles:
+
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
+
* inchi key:
+
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
+
* common name:
+
** ent-kaur-16-en-19-oate
+
* molecular weight:
+
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
** ent-kaurenoate
 
** ent-kaurenoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN1F-20]]
* [[RXN-7580]]
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5531]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[PWY-7159]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104130004
+
{{#set: reaction associated=RXN1F-20}}
* PUBCHEM:
+
{{#set: pathway associated=PWY-5531|CHLOROPHYLL-SYN|PWY-7159}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
+
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
+
{{#set: common name=ent-kaur-16-en-19-oate}}
+
{{#set: molecular weight=301.448    }}
+
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
+
{{#set: produced by=RXN-7580}}
+

Latest revision as of 16:25, 23 May 2018

Gene CHC_T00000990001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links