Difference between revisions of "TRNAs-containing-epoxy-quenosine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] == * smiles: ** CCC=CCC=CCC=CC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs-containing-epoxy-quenosine tRNAs-containing-epoxy-quenosine] == * common name: ** an epox...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z8Z11Z14Z17Z-EICOSAPENTAENOATE 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs-containing-epoxy-quenosine tRNAs-containing-epoxy-quenosine] ==
−
* smiles:
+
−
** CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M
+
 
* common name:
 
* common name:
−
** icosapentaenoate
+
** an epoxyqueuosine34 in tRNA
−
* molecular weight:
+
−
** 301.448   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate
+
** an epoxyqueuosine at position 34 of a tRNA containing GUN anticodon
−
** timnodonic acid
+
−
** (5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate
+
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid
+
−
** EPA
+
−
** (5Z,8Z,11Z,14Z,17Z)-icosapentaenoate
+
−
** eicosapentaenoate
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-12978]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1342]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an epoxyqueuosine34 in tRNA}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245749 25245749]
+
{{#set: common name=an epoxyqueuosine at position 34 of a tRNA containing GUN anticodon}}
−
* CHEBI:
+
{{#set: produced by=RXN0-1342}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58562 58562]
+
−
* Wikipedia : Eicosapentaenoate
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C06428 C06428]
+
−
* HMDB : HMDB01999
+
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCCCC(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JAZBEHYOTPTENJ-JLNKQSITSA-M}}
+
−
{{#set: common name=icosapentaenoate}}
+
−
{{#set: molecular weight=301.448    }}
+
−
{{#set: common name=(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoate|timnodonic acid|(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoate|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid|EPA|(5Z,8Z,11Z,14Z,17Z)-icosapentaenoate|eicosapentaenoate}}
+
−
{{#set: consumed by=RXN-12978}}
+

Latest revision as of 15:04, 23 May 2018

Metabolite tRNAs-containing-epoxy-quenosine

  • common name:
    • an epoxyqueuosine34 in tRNA
  • Synonym(s):
    • an epoxyqueuosine at position 34 of a tRNA containing GUN anticodon

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TRNAs-containing-epoxy-quenosine&oldid=13133"