Difference between revisions of "SINAPALDEHYDE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-flavodoxins Oxidized-flavodoxins] == * common name: ** an oxidized flavodoxin * Synony...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPALDEHYDE SINAPALDEHYDE] == |
+ | * smiles: | ||
+ | ** COC1(C=C(C=CC=O)C=C(OC)C(O)=1) | ||
+ | * molecular weight: | ||
+ | ** 208.213 | ||
+ | * inchi key: | ||
+ | ** InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** sinapaldehyde |
* Synonym(s): | * Synonym(s): | ||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-1125]] |
+ | * [[RXN-8014]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-1124]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27949 27949] |
− | {{#set: consumed by= | + | * METABOLIGHTS : MTBLC27949 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280802 5280802] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05610 C05610] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4444359.html 4444359] | ||
+ | {{#set: smiles=COC1(C=C(C=CC=O)C=C(OC)C(O)=1)}} | ||
+ | {{#set: molecular weight=208.213 }} | ||
+ | {{#set: inchi key=InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N}} | ||
+ | {{#set: common name=sinapaldehyde}} | ||
+ | {{#set: consumed by=RXN-1125|RXN-8014}} | ||
+ | {{#set: reversible reaction associated=RXN-1124}} |
Latest revision as of 17:15, 9 January 2019
Contents
Metabolite SINAPALDEHYDE
- smiles:
- COC1(C=C(C=CC=O)C=C(OC)C(O)=1)
- molecular weight:
- 208.213
- inchi key:
- InChIKey=CDICDSOGTRCHMG-ONEGZZNKSA-N
- common name:
- sinapaldehyde
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links