Difference between revisions of "RXN-10917"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] == * smiles: ** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1) * inchi key:...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEHYDROQUINATE DEHYDROQUINATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10917 RXN-10917] ==
* smiles:
+
* direction:
** C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WVMWZWGZRAXUBK-SYTVJDICSA-M
+
 
* common name:
 
* common name:
** 3-dehydroquinate
+
** aldehyde dehydrogenase, (NAD) activity
* molecular weight:
+
* ec number:
** 189.144   
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
** 3-dehydroquinic acid
 
** 5-dehydroquinic acid
 
** 5-dehydroquinate
 
** 5-de-H-quinate
 
** rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[3-DEHYDROQUINATE-SYNTHASE-RXN]]
+
** 1 [[CPD-11876]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[VANILLYL_MANDELATE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
** 1 3-methoxy-4-hydroxyphenylglycolaldehyde[c] '''+''' 1 NAD+[c] '''+''' 1 H2O[c] '''=>''' 1 NADH[c] '''+''' 2 H+[c] '''+''' 1 vanillyl mandelate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008341001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008341001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-6342]], noradrenaline and adrenaline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6342 PWY-6342]
 +
** '''4''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 10534-44-8
+
* LIGAND-RXN:
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R04891 R04891]
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460271 5460271]
+
{{#set: direction=LEFT-TO-RIGHT}}
* HMDB : HMDB12710
+
{{#set: common name=aldehyde dehydrogenase, (NAD) activity}}
* LIGAND-CPD:
+
{{#set: ec number=EC-1.2.1.3}}
** [http://www.genome.jp/dbget-bin/www_bget?C00944 C00944]
+
{{#set: gene associated=CHC_T00008341001|CHC_T00008341001_1}}
* CHEMSPIDER:
+
{{#set: in pathway=PWY-6342}}
** [http://www.chemspider.com/Chemical-Structure.4573866.html 4573866]
+
{{#set: reconstruction category=orthology|annotation}}
* CHEBI:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32364 32364]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
* BIGG : 3dhq
+
{{#set: smiles=C1(C(O)C(O)C(=O)CC(O)(C([O-])=O)1)}}
+
{{#set: inchi key=InChIKey=WVMWZWGZRAXUBK-SYTVJDICSA-M}}
+
{{#set: common name=3-dehydroquinate}}
+
{{#set: molecular weight=189.144    }}
+
{{#set: common name=3-dehydroquinic acid|5-dehydroquinic acid|5-dehydroquinate|5-de-H-quinate|rel-(1R,3R,4S)-1,3,4-trihydroxy-5-oxocyclohexanecarboxylate}}
+
{{#set: produced by=3-DEHYDROQUINATE-SYNTHASE-RXN}}
+
{{#set: consumed or produced by=3-DEHYDROQUINATE-DEHYDRATASE-RXN}}
+

Latest revision as of 17:12, 9 January 2019

Reaction RXN-10917

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • aldehyde dehydrogenase, (NAD) activity
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-methoxy-4-hydroxyphenylglycolaldehyde[c] + 1 NAD+[c] + 1 H2O[c] => 1 NADH[c] + 2 H+[c] + 1 vanillyl mandelate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6342, noradrenaline and adrenaline degradation: PWY-6342
    • 4 reactions found over 13 reactions in the full pathway

Reconstruction information

External links