Difference between revisions of "CPD-8678"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13524 CPD-13524] == * smiles: ** CC(=CC=CC(C)=CCO)C=CC1(=C(C)CCCC(C)(C)1) * inchi key: ** I...") |
|||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8678 CPD-8678] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO |
| + | * molecular weight: | ||
| + | ** 309.425 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M |
* common name: | * common name: | ||
| − | ** | + | ** 9(S)-HPOTE |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid |
| − | ** | + | ** 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8497]] |
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60962 60962] |
| − | + | ||
| − | + | ||
| − | * | + | |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852426 49852426] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16321 C16321] |
| − | + | {{#set: smiles=CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO}} | |
| − | + | {{#set: molecular weight=309.425 }} | |
| − | + | {{#set: inchi key=InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M}} | |
| − | + | {{#set: common name=9(S)-HPOTE}} | |
| − | + | {{#set: common name=9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid|9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate}} | |
| − | {{#set: smiles= | + | {{#set: produced by=RXN-8497}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:20, 9 January 2019
Contents
Metabolite CPD-8678
- smiles:
- CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO
- molecular weight:
- 309.425
- inchi key:
- InChIKey=RWKJTIHNYSIIHW-MEBVTJQTSA-M
- common name:
- 9(S)-HPOTE
- Synonym(s):
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoic acid
- 9(S)-hydroperoxy-10(E),12(Z),15(Z)-octadecatrienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CC=CC(CCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.
