Difference between revisions of "FRU1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11521 RXN-11521] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11521 RXN-11521] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
 +
* molecular weight:
 +
** 258.121   
 +
* inchi key:
 +
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
 +
* common name:
 +
** β-D-fructofuranose 1-phosphate
 
* Synonym(s):
 
* Synonym(s):
 +
** β-D-fructofuranose-1-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-8631]]
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[7-METHYLXANTHINE]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-12481]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 H2O[c] '''+''' 1 7-methylxanthine[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 7-methylurate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00000194001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00006932001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
* [[CHC_T00006216001_1]]
+
−
** [[pantograph]]-[[a.taliana]]
+
−
== Pathways  ==
+
−
* [[PWY-6632]], caffeine degradation IV (bacteria, via demethylation and oxidation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6632 PWY-6632]
+
−
** '''4''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[a.taliana]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* BIGG : f1p
−
** [http://www.genome.jp/dbget-bin/www_bget?R07979 R07979]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216]
−
{{#set: gene associated=CHC_T00000194001_1|CHC_T00006932001_1|CHC_T00006216001_1}}
+
* CAS : 15978-08-2
−
{{#set: in pathway=PWY-6632}}
+
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=258.121    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}}
−
{{#set: reconstruction source=a.taliana}}
+
{{#set: common name=β-D-fructofuranose 1-phosphate}}
 +
{{#set: common name=β-D-fructofuranose-1-P}}
 +
{{#set: consumed by=RXN-8631}}

Latest revision as of 17:16, 9 January 2019

Metabolite FRU1P

  • smiles:
    • C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
  • molecular weight:
    • 258.121
  • inchi key:
    • InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
  • common name:
    • β-D-fructofuranose 1-phosphate
  • Synonym(s):
    • β-D-fructofuranose-1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • BIGG : f1p
  • PUBCHEM:
  • CAS : 15978-08-2
"C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=FRU1P&oldid=22901"