Difference between revisions of "CPD-13576"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROLIPOAMIDE DIHYDROLIPOAMIDE] == * smiles: ** C(CCC(N)=O)CC(S)CCS * inchi key: ** InChIKey...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) |
+ | * molecular weight: | ||
+ | ** 264.169 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K |
* common name: | * common name: | ||
− | ** | + | ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** cThz-P | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12610]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890] |
− | * | + | * PUBCHEM: |
− | {{#set: smiles=C( | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}} |
− | {{#set: common name= | + | {{#set: molecular weight=264.169 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}} |
− | {{#set: consumed by= | + | {{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} |
+ | {{#set: common name=cThz-P}} | ||
+ | {{#set: consumed by=RXN-12610}} |
Latest revision as of 17:17, 9 January 2019
Contents
Metabolite CPD-13576
- smiles:
- CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
- molecular weight:
- 264.169
- inchi key:
- InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
- common name:
- 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
- Synonym(s):
- cThz-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.