Difference between revisions of "3-oxo-D5-steroids"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-D5-steroids 3-oxo-D5-steroids] == * common name: ** a 3-oxo-δ5-steroid * Synonym(s)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8612 CPD-8612] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-D5-steroids 3-oxo-D5-steroids] ==
* smiles:
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C
+
* inchi key:
+
** InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N
+
 
* common name:
 
* common name:
** 4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol
+
** a 3-oxo-δ5-steroid
* molecular weight:
+
** 428.697   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN66-17]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-16]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[1.1.1.145-RXN]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 3-oxo-δ5-steroid}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263319 44263319]
+
{{#set: reversible reaction associated=1.1.1.145-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87046 87046]
+
* HMDB : HMDB12168
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)([CH]=O)C(O)CC3)))CC4)))C}}
+
{{#set: inchi key=InChIKey=WWTBBRMTEFBUND-WKYRUEGDSA-N}}
+
{{#set: common name=4α-formyl-4β-methyl-5α-cholesta-8-en-3β-ol}}
+
{{#set: molecular weight=428.697    }}
+
{{#set: consumed by=RXN66-17}}
+
{{#set: produced by=RXN66-16}}
+

Latest revision as of 14:51, 23 May 2018

Metabolite 3-oxo-D5-steroids

  • common name:
    • a 3-oxo-δ5-steroid
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links