Difference between revisions of "RXN-14201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * smiles: ** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP(...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14201 RXN-14201] ==
* smiles:
+
* direction:
** CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
* common name:
+
** FADH2
+
* molecular weight:
+
** 785.556   
+
 
* Synonym(s):
 
* Synonym(s):
** flavin adenine dinucleotide reduced
 
** 1,5-dihydro-FAD
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[GTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[GMP]][c] '''+''' 2 [[Pi]][c] '''+''' 2 [[PROTON]][c]
* [[RXN-14264]]
+
* With common name(s):
 +
** 1 GTP[c] '''+''' 2 H2O[c] '''=>''' 1 GMP[c] '''+''' 2 phosphate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003677001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00001236001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 1910-41-4
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC58307
+
{{#set: ec number=EC-3.6.1.5}}
* PUBCHEM:
+
{{#set: gene associated=CHC_T00003677001_1|CHC_T00001236001_1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931118 46931118]
+
{{#set: in pathway=}}
* HMDB : HMDB01197
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
** [http://www.genome.jp/dbget-bin/www_bget?C01352 C01352]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58307 58307]
+
* BIGG : fadh2
+
{{#set: smiles=CC1(=C(C)C=C2(N(C3(NC(NC(=O)C(NC(=C1)2)=3)=O))CC(O)C(O)C(O)COP(OP([O-])(OCC6(C(O)C(O)C(N5(C=NC4(C(N)=NC=NC=45)))O6))=O)([O-])=O))}}
+
{{#set: inchi key=InChIKey=YPZRHBJKEMOYQH-UYBVJOGSSA-L}}
+
{{#set: common name=FADH2}}
+
{{#set: molecular weight=785.556    }}
+
{{#set: common name=flavin adenine dinucleotide reduced|1,5-dihydro-FAD}}
+
{{#set: consumed or produced by=RXN-14264}}
+

Latest revision as of 18:15, 9 January 2019

Reaction RXN-14201

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GTP[c] + 2 H2O[c] => 1 GMP[c] + 2 phosphate[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links