Difference between revisions of "HOMO-CIT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009278001 == * left end position: ** 437445 * transcription direction: ** NEGATIVE * right end position: ** 438602 * centisome position: ** 76...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009278001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] ==
* left end position:
+
* smiles:
** 437445
+
** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 203.128   
* right end position:
+
* inchi key:
** 438602
+
** InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K
* centisome position:
+
* common name:
** 76.15461   
+
** (2R)-homocitrate
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxybutane-1,2,4-tricarboxylate
 +
** homocitric acid
 +
** 3-hydroxy-3-carboxyadipic acid
 +
** (2R)-2-hydroxybutane-1,2,4-tricarboxylate
 +
** (R)-2-hydroxybutane-1,2,4-tricarboxylate
 +
** homocitrate
 +
** (R)-homocitrate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
== Reaction(s) known to produce the compound ==
** original_genome
+
== Reaction(s) of unknown directionality ==
***automated-name-match
+
* [[RXN-13722]]
* [[RXN-15006]]
+
** original_genome
+
***automated-name-match
+
== Pathways associated ==
+
* [[PWY-5154]]
+
* [[GLUTORN-PWY]]
+
* [[ARGSYNBSUB-PWY]]
+
* [[PWY-7400]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=437445}}
+
* CAS : 3562-74-1
{{#set: transcription direction=NEGATIVE}}
+
* HMDB : HMDB03518
{{#set: right end position=438602}}
+
* CHEMSPIDER:
{{#set: centisome position=76.15461    }}
+
** [http://www.chemspider.com/Chemical-Structure.20171681.html 20171681]
{{#set: reaction associated=N-ACETYLGLUTPREDUCT-RXN|RXN-15006}}
+
* CHEBI:
{{#set: pathway associated=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY|PWY-7400}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58884 58884]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01251 C01251]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849228 20849228]
 +
{{#set: smiles=C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O}}
 +
{{#set: molecular weight=203.128    }}
 +
{{#set: inchi key=InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K}}
 +
{{#set: common name=(2R)-homocitrate}}
 +
{{#set: common name=2-hydroxybutane-1,2,4-tricarboxylate|homocitric acid|3-hydroxy-3-carboxyadipic acid|(2R)-2-hydroxybutane-1,2,4-tricarboxylate|(R)-2-hydroxybutane-1,2,4-tricarboxylate|homocitrate|(R)-homocitrate}}
 +
{{#set: reversible reaction associated=RXN-13722}}

Latest revision as of 17:19, 9 January 2019

Metabolite HOMO-CIT

  • smiles:
    • C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O
  • molecular weight:
    • 203.128
  • inchi key:
    • InChIKey=XKJVEVRQMLKSMO-SSDOTTSWSA-K
  • common name:
    • (2R)-homocitrate
  • Synonym(s):
    • 2-hydroxybutane-1,2,4-tricarboxylate
    • homocitric acid
    • 3-hydroxy-3-carboxyadipic acid
    • (2R)-2-hydroxybutane-1,2,4-tricarboxylate
    • (R)-2-hydroxybutane-1,2,4-tricarboxylate
    • homocitrate
    • (R)-homocitrate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.