Difference between revisions of "OXIDIZED-GLUTATHIONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(O)CO) * inchi key: **...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(SSCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O |
| + | * molecular weight: | ||
| + | ** 610.61 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=YPZRWBKMTBYPTK-BJDJZHNGSA-L |
* common name: | * common name: | ||
| − | ** | + | ** glutathione disulfide |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** glutathione oxidized | ||
| + | ** glutathione ox | ||
| + | ** GSSG | ||
| + | ** oxidized glutathione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLUTATHIONE-REDUCT-NADPH-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[1.11.1.12-RXN]] |
| + | * [[1.8.5.1-RXN]] | ||
| + | * [[1.8.4.9-RXN]] | ||
| + | * [[RXN-12721]] | ||
| + | * [[GLUTATHIONE-PEROXIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC58297 | ||
| + | * BIGG : gthox | ||
| + | * CAS : 27025-41-8 | ||
| + | * HMDB : HMDB03337 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58297 58297] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00127 C00127] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40467895 40467895] |
| − | {{#set: smiles= | + | {{#set: smiles=C(SSCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=610.61 }} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=YPZRWBKMTBYPTK-BJDJZHNGSA-L}} |
| − | {{#set: | + | {{#set: common name=glutathione disulfide}} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=glutathione oxidized|glutathione ox|GSSG|oxidized glutathione}} |
| + | {{#set: consumed by=GLUTATHIONE-REDUCT-NADPH-RXN}} | ||
| + | {{#set: produced by=1.11.1.12-RXN|1.8.5.1-RXN|1.8.4.9-RXN|RXN-12721|GLUTATHIONE-PEROXIDASE-RXN}} | ||
Latest revision as of 17:19, 9 January 2019
Contents
Metabolite OXIDIZED-GLUTATHIONE
- smiles:
- C(SSCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- molecular weight:
- 610.61
- inchi key:
- InChIKey=YPZRWBKMTBYPTK-BJDJZHNGSA-L
- common name:
- glutathione disulfide
- Synonym(s):
- glutathione oxidized
- glutathione ox
- GSSG
- oxidized glutathione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58297
- BIGG : gthox
- CAS : 27025-41-8
- HMDB : HMDB03337
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(SSCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
