|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=INORGPYROPHOSPHAT-RXN INORGPYROPHOSPHAT-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13040 CPD-13040] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** CCCC(OCC(OC(CCC)=O)CO)=O |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/3.6.1.1 EC-3.6.1.1] | + | ** 232.276 |
| + | * inchi key: |
| + | ** InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N |
| + | * common name: |
| + | ** 1,2-dibutyrin |
| * Synonym(s): | | * Synonym(s): |
| + | ** glycerol 1,2-dibutanoate |
| + | ** β-dibutyrin |
| + | ** butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester |
| + | ** dibutyrylglycerol |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | == Reaction(s) known to produce the compound == |
− | ** 1 [[WATER]][c] '''+''' 1 [[PPI]][c] '''=>''' 1 [[PROTON]][c] '''+''' 2 [[Pi]][c]
| + | * [[RXN-12086]] |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 H2O[c] '''+''' 1 diphosphate[c] '''=>''' 1 H+[c] '''+''' 2 phosphate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00008749001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | * [[CHC_T00006490001_1]]
| + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-7805]], aminomethylphosphonate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7805 PWY-7805] | + | |
− | ** '''2''' reactions found over '''8''' reactions in the full pathway
| + | |
− | * [[PWY-7807]], glyphosate degradation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7807 PWY-7807]
| + | |
− | ** '''2''' reactions found over '''7''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | *** [[a.taliana]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24576 24576] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76537 76537] |
− | * LIGAND-RXN: | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00004 R00004] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5327007 5327007] |
− | * UNIPROT:
| + | * CAS : 24814-35-5 |
− | ** [http://www.uniprot.org/uniprot/P21616 P21616]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/P31414 P31414]
| + | ** [http://www.chemspider.com/Chemical-Structure.8352519.html 8352519] |
− | ** [http://www.uniprot.org/uniprot/P28239 P28239] | + | {{#set: smiles=CCCC(OCC(OC(CCC)=O)CO)=O}} |
− | ** [http://www.uniprot.org/uniprot/P37980 P37980] | + | {{#set: molecular weight=232.276 }} |
− | ** [http://www.uniprot.org/uniprot/P84491 P84491] | + | {{#set: inchi key=InChIKey=AWHAUPZHZYUHOM-VIFPVBQESA-N}} |
− | ** [http://www.uniprot.org/uniprot/O59570 O59570]
| + | {{#set: common name=1,2-dibutyrin}} |
− | ** [http://www.uniprot.org/uniprot/Q9S941 Q9S941]
| + | {{#set: common name=glycerol 1,2-dibutanoate|β-dibutyrin|butanoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester|dibutyrylglycerol}} |
− | ** [http://www.uniprot.org/uniprot/Q9S939 Q9S939]
| + | {{#set: produced by=RXN-12086}} |
− | ** [http://www.uniprot.org/uniprot/Q9S936 Q9S936]
| + | |
− | ** [http://www.uniprot.org/uniprot/O26363 O26363]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S940 Q9S940]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S938 Q9S938]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S937 Q9S937]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PHM9 Q9PHM9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UY24 Q9UY24]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JVG3 Q9JVG3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47593 P47593]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q974Y8 Q974Y8]
| + | |
− | ** [http://www.uniprot.org/uniprot/O05724 O05724]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19514 P19514]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00817 P00817]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A7A9 P0A7A9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13998 P13998]
| + | |
− | ** [http://www.uniprot.org/uniprot/P19117 P19117]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21216 P21216]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R5T3 Q9R5T3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37981 P37981]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43801 Q43801]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43798 Q43798]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43797 Q43797]
| + | |
− | ** [http://www.uniprot.org/uniprot/P50308 P50308]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43796 Q43796]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93409 P93409]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q8H616 Q8H616]
| + | |
− | ** [http://www.uniprot.org/uniprot/P93410 P93410]
| + | |
− | ** [http://www.uniprot.org/uniprot/P75250 P75250]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49071 Q49071]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48556 O48556]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22537 O22537]
| + | |
− | ** [http://www.uniprot.org/uniprot/O82793 O82793]
| + | |
− | ** [http://www.uniprot.org/uniprot/O23979 O23979]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49949 O49949]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43187 Q43187]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22124 O22124]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42650 Q42650]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42651 Q42651]
| + | |
− | ** [http://www.uniprot.org/uniprot/O65151 O65151]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: ec number=EC-3.6.1.1}} | + | |
− | {{#set: gene associated=CHC_T00008749001_1|CHC_T00006490001_1}} | + | |
− | {{#set: in pathway=PWY-7805|PWY-7807}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}} | + | |