Difference between revisions of "EDTA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9548 RXN-9548] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/3....") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EDTA EDTA] == |
− | * | + | * smiles: |
− | ** | + | ** C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O |
− | * | + | * molecular weight: |
− | ** | + | ** 290.229 |
+ | * inchi key: | ||
+ | ** InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L | ||
+ | * common name: | ||
+ | ** EDTA | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ethylenediaminetetraacetic acid | ||
+ | ** ethylenediaminetetraacetate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[TransportSeed_EDTA]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[TransportSeed_EDTA]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | * [[ExchangeSeed_EDTA]] | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42191 42191] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201827 25201827] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00284 C00284] |
+ | * HMDB : HMDB15109 | ||
+ | {{#set: smiles=C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O}} | ||
+ | {{#set: molecular weight=290.229 }} | ||
+ | {{#set: inchi key=InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=EDTA}} | ||
+ | {{#set: common name=ethylenediaminetetraacetic acid|ethylenediaminetetraacetate}} | ||
+ | {{#set: consumed by=TransportSeed_EDTA}} | ||
+ | {{#set: produced by=TransportSeed_EDTA}} | ||
+ | {{#set: reversible reaction associated=ExchangeSeed_EDTA}} |
Latest revision as of 18:20, 9 January 2019
Contents
Metabolite EDTA
- smiles:
- C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O
- molecular weight:
- 290.229
- inchi key:
- InChIKey=KCXVZYZYPLLWCC-UHFFFAOYSA-L
- common name:
- EDTA
- Synonym(s):
- ethylenediaminetetraacetic acid
- ethylenediaminetetraacetate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C[N+](CC([O-])=O)CC([O-])=O)[N+](CC([O-])=O)CC([O-])=O" cannot be used as a page name in this wiki.