Difference between revisions of "CPD-12126"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14353 RXN-14353] == * direction: ** LEFT-TO-RIGHT * common name: ** Starch phosphorylase * ec n...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14353 RXN-14353] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12126 CPD-12126] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C
 +
* molecular weight:
 +
** 787.263   
 +
* inchi key:
 +
** InChIKey=KNWZIPKBOGOFFC-UVZVDVBNSA-N
 
* common name:
 
* common name:
−
** Starch phosphorylase
+
** menaquinol-9
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** MKH2-9
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Pi]][c] '''+''' 1 [[Soluble-Heteroglycans]][c] '''=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[Soluble-Heteroglycans]][c]
+
* [[RXN-9205]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 phosphate[c] '''+''' 1 a plant soluble heteroglycan[c] '''=>''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 a plant soluble heteroglycan[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00008988001]]
+
−
** ORIGINAL_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[CHC_T00008988001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-7238]], sucrose biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7238 PWY-7238]
+
−
** '''6''' reactions found over '''8''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[original_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=Starch phosphorylase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84541 84541]
−
{{#set: ec number=EC-2.4.1.1}}
+
* PUBCHEM:
−
{{#set: gene associated=CHC_T00008988001|CHC_T00008988001_1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479508 45479508]
−
{{#set: in pathway=PWY-7238}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=787.263    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=KNWZIPKBOGOFFC-UVZVDVBNSA-N}}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: common name=menaquinol-9}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=MKH2-9}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: produced by=RXN-9205}}
−
{{#set: reconstruction source=original_genome}}
+

Latest revision as of 17:21, 9 January 2019

Metabolite CPD-12126

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C
  • molecular weight:
    • 787.263
  • inchi key:
    • InChIKey=KNWZIPKBOGOFFC-UVZVDVBNSA-N
  • common name:
    • menaquinol-9
  • Synonym(s):
    • MKH2-9

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-12126&oldid=22991"