Difference between revisions of "CPD-11020"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00002327001_1 == * Synonym(s): == Reactions associated == * RXN0-7023 ** pantograph-galdieria.sulphuraria == Pathways associated ==...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] == |
+ | * smiles: | ||
+ | ** C(=O)([O-])C(=O)CC(O)CCl | ||
+ | * molecular weight: | ||
+ | ** 165.553 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M | ||
+ | * common name: | ||
+ | ** 5-chloro-4-hydroxy-2-oxopentanoate | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5-chloro-4-hydroxy-2-oxovalerate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-11717]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580] | ||
+ | {{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}} | ||
+ | {{#set: molecular weight=165.553 }} | ||
+ | {{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}} | ||
+ | {{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}} | ||
+ | {{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}} | ||
+ | {{#set: produced by=RXN-11717}} |
Latest revision as of 18:26, 9 January 2019
Contents
Metabolite CPD-11020
- smiles:
- C(=O)([O-])C(=O)CC(O)CCl
- molecular weight:
- 165.553
- inchi key:
- InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
- common name:
- 5-chloro-4-hydroxy-2-oxopentanoate
- Synonym(s):
- 5-chloro-4-hydroxy-2-oxovalerate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.