Difference between revisions of "CPD-11020"

Latest revision as of 17:26, 9 January 2019

"C(=O)([O-])C(=O)CC(O)CCl" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene CHC_T00002327001_1 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11020 CPD-11020] ==
+* smiles:
+** C(=O)([O-])C(=O)CC(O)CCl
+* molecular weight:
+** 165.553
+* inchi key:
+** InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M
+* common name:
+** 5-chloro-4-hydroxy-2-oxopentanoate
 * Synonym(s):
+** 5-chloro-4-hydroxy-2-oxovalerate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[RXN0-7023]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[galdieria.sulphuraria]]
+* [[RXN-11717]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: reaction associated=RXN0-7023}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859580 49859580]
+{{#set: smiles=C(=O)([O-])C(=O)CC(O)CCl}}
+{{#set: molecular weight=165.553    }}
+{{#set: inchi key=InChIKey=FHWPHVIGZZAXIQ-VKHMYHEASA-M}}
+{{#set: common name=5-chloro-4-hydroxy-2-oxopentanoate}}
+{{#set: common name=5-chloro-4-hydroxy-2-oxovalerate}}
+{{#set: produced by=RXN-11717}}