Difference between revisions of "CHC T00003825001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] == * smiles: ** C(C(=O)[O-])C(O)[CH]=O * inchi key: ** InChIKey=QWHDXIUUXW...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16618 CPD-16618] ==
+
== Gene CHC_T00003825001_1 ==
* smiles:
+
** C(C(=O)[O-])C(O)[CH]=O
+
* inchi key:
+
** InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M
+
* common name:
+
** L-malic semialdehyde
+
* molecular weight:
+
** 117.081   
+
 
* Synonym(s):
 
* Synonym(s):
** (3R)-3-hydroxy-4-oxobutanoate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-6002]]
+
* Reaction: [[CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[PWY-1121]]
 +
* [[PWY-7498]]
 +
* [[PWY-7398]]
 +
* [[PWY-361]]
 +
* [[PWY-6039]]
 +
* [[PWY-5710]]
 +
* [[PWY-6792]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=CAFFEOYL-COA-O-METHYLTRANSFERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658049 90658049]
+
{{#set: pathway associated=PWY-1121|PWY-7498|PWY-7398|PWY-361|PWY-6039|PWY-5710|PWY-6792}}
{{#set: smiles=C(C(=O)[O-])C(O)[CH]=O}}
+
{{#set: inchi key=InChIKey=QWHDXIUUXWGQME-GSVOUGTGSA-M}}
+
{{#set: common name=L-malic semialdehyde}}
+
{{#set: molecular weight=117.081    }}
+
{{#set: common name=(3R)-3-hydroxy-4-oxobutanoate}}
+
{{#set: consumed by=RXN-6002}}
+

Latest revision as of 17:18, 9 January 2019

Gene CHC_T00003825001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links