Difference between revisions of "RXN-17017"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] == * smiles: ** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13695 CPD-13695] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17017 RXN-17017] ==
−
* smiles:
+
* direction:
−
** CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J
+
 
* common name:
 
* common name:
−
** 3,24-dioxocholest-4-en-26-oyl-CoA
+
** glycerol-3-phosphate acyltransferase
−
* molecular weight:
+
* ec number:
−
** 1174.098   
+
** [http://enzyme.expasy.org/EC/2.3.1.15 EC-2.3.1.15]
 
* Synonym(s):
 
* Synonym(s):
−
** cholest-4-en--3,24,dione-26-oyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12705]]
+
** 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Myristoyl-ACPs]][c] '''=>''' 1 [[CPD-18379]][c] '''+''' 1 [[ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 sn-glycerol 3-phosphate[c] '''+''' 1 a myristoyl-[acp][c] '''=>''' 1 1-myristoylglycerol 3-phosphate[c] '''+''' 1 a holo-[acyl-carrier protein][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008773001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008773001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515485 102515485]
+
{{#set: common name=glycerol-3-phosphate acyltransferase}}
−
{{#set: smiles=CC(CCC(=O)C(C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])C)[CH]6(CC[CH]7([CH]5(CCC4(=CC(=O)CCC(C)4[CH]5CCC(C)67))))}}
+
{{#set: ec number=EC-2.3.1.15}}
−
{{#set: inchi key=InChIKey=ZVFUUGBGZMBUAN-KZNRQMKSSA-J}}
+
{{#set: gene associated=CHC_T00008773001_1|CHC_T00008773001}}
−
{{#set: common name=3,24-dioxocholest-4-en-26-oyl-CoA}}
+
{{#set: in pathway=}}
−
{{#set: molecular weight=1174.098    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=cholest-4-en--3,24,dione-26-oyl-CoA}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
{{#set: produced by=RXN-12705}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 18:23, 9 January 2019

Reaction RXN-17017

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • glycerol-3-phosphate acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 sn-glycerol 3-phosphate[c] + 1 a myristoyl-[acp][c] => 1 1-myristoylglycerol 3-phosphate[c] + 1 a holo-[acyl-carrier protein][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-17017&oldid=23039"