Difference between revisions of "CPD-12127"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-PHOSPHATIDYL-SERINE L-1-PHOSPHATIDYL-SERINE] == * common name: ** a 3-O-sn-phosphatidyl-L-s...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12127 CPD-12127] == |
+ | * smiles: | ||
+ | ** CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C | ||
+ | * molecular weight: | ||
+ | ** 855.381 | ||
+ | * inchi key: | ||
+ | ** InChIKey=WLKIROMWGYXJMA-UQUNHUMXSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** menaquinol-10 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** MKH2-10 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9361]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84544 84544] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24826776 24826776] |
+ | {{#set: smiles=CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C}} | ||
+ | {{#set: molecular weight=855.381 }} | ||
+ | {{#set: inchi key=InChIKey=WLKIROMWGYXJMA-UQUNHUMXSA-N}} | ||
+ | {{#set: common name=menaquinol-10}} | ||
+ | {{#set: common name=MKH2-10}} | ||
+ | {{#set: produced by=RXN-9361}} |
Latest revision as of 17:26, 9 January 2019
Contents
Metabolite CPD-12127
- smiles:
- CC(=CCCC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(C)=C(O)C2(C=CC=CC(C(O)=1)=2)))C)C
- molecular weight:
- 855.381
- inchi key:
- InChIKey=WLKIROMWGYXJMA-UQUNHUMXSA-N
- common name:
- menaquinol-10
- Synonym(s):
- MKH2-10
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links