Difference between revisions of "RXN-9787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] == * smiles: ** CCCCCCCCCC(=O)[O-] * inchi key: ** InChIKey=GHVNFZFCNZKVNT-U...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3617 CPD-3617] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] ==
* smiles:
+
* direction:
** CCCCCCCCCC(=O)[O-]
+
** REVERSIBLE
* inchi key:
+
** InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
** decanoate
+
** cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
* molecular weight:
+
* ec number:
** 171.259   
+
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
** caprate
 
** decanoic acid
 
** n-decanoate
 
** n-capric acid
 
** caprinic acid
 
** caprinate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-13614]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CYS]][c] '''+''' 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''<=>''' 1 [[Sulfurylated-ThiI]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[RXN-16653]]
+
** 1 L-cysteine[c] '''+''' 1 a ThiI sulfur-carrier protein[c] '''<=>''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c] '''+''' 1 L-alanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008053001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000657001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009510001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 334-48-5
+
{{#set: direction=REVERSIBLE}}
* METABOLIGHTS : MTBLC27689
+
{{#set: common name=cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase}}
* PUBCHEM:
+
{{#set: ec number=EC-2.8.1.7}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4678093 4678093]
+
{{#set: gene associated=CHC_T00008053001_1|CHC_T00000657001_1|CHC_T00009510001_1}}
* HMDB : HMDB00511
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C01571 C01571]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.chemspider.com/Chemical-Structure.3866366.html 3866366]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27689 27689]
+
* BIGG : dca
+
{{#set: smiles=CCCCCCCCCC(=O)[O-]}}
+
{{#set: inchi key=InChIKey=GHVNFZFCNZKVNT-UHFFFAOYSA-M}}
+
{{#set: common name=decanoate}}
+
{{#set: molecular weight=171.259    }}
+
{{#set: common name=caprate|decanoic acid|n-decanoate|n-capric acid|caprinic acid|caprinate}}
+
{{#set: consumed by=RXN-13614}}
+
{{#set: consumed or produced by=RXN-16653}}
+

Latest revision as of 17:25, 9 January 2019

Reaction RXN-9787

  • direction:
    • REVERSIBLE
  • common name:
    • cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase" cannot be used as a page name in this wiki.