Difference between revisions of "CPD-785"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6-Phosphogluco-Maltodextrins 6-Phosphogluco-Maltodextrins] == * common name: ** a 6-phosphogluc...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-785 CPD-785] == |
| + | * smiles: | ||
| + | ** C(CC(C=CC(C([O-])=O)=O)C([O-])=O)([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 213.123 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WHGVLEMQINVDLH-QPHDTYRISA-K | ||
* common name: | * common name: | ||
| − | ** | + | ** (3E,5R)-5-carboxy-2-oxohept-3-enedioate |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** OPET |
| + | ** 5-carboxy-2-oxohex-3-ene-1,6-dioate | ||
| + | ** 5-oxopent-3-ene-1,2,5-tricarboxylate | ||
| + | ** 1-oxopent-3-ene-1,4,5-tricarboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[4.1.1.68-RXN]] | ||
| + | * [[CARBOXY-OXOHEPT-ENEDIOATE-DECARBOXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87491 87491] |
| − | {{#set: consumed | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91828236 91828236] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04052 C04052] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.19951288.html 19951288] | ||
| + | {{#set: smiles=C(CC(C=CC(C([O-])=O)=O)C([O-])=O)([O-])=O}} | ||
| + | {{#set: molecular weight=213.123 }} | ||
| + | {{#set: inchi key=InChIKey=WHGVLEMQINVDLH-QPHDTYRISA-K}} | ||
| + | {{#set: common name=(3E,5R)-5-carboxy-2-oxohept-3-enedioate}} | ||
| + | {{#set: common name=OPET|5-carboxy-2-oxohex-3-ene-1,6-dioate|5-oxopent-3-ene-1,2,5-tricarboxylate|1-oxopent-3-ene-1,4,5-tricarboxylate}} | ||
| + | {{#set: consumed by=4.1.1.68-RXN|CARBOXY-OXOHEPT-ENEDIOATE-DECARBOXY-RXN}} | ||
Latest revision as of 17:28, 9 January 2019
Contents
Metabolite CPD-785
- smiles:
- C(CC(C=CC(C([O-])=O)=O)C([O-])=O)([O-])=O
- molecular weight:
- 213.123
- inchi key:
- InChIKey=WHGVLEMQINVDLH-QPHDTYRISA-K
- common name:
- (3E,5R)-5-carboxy-2-oxohept-3-enedioate
- Synonym(s):
- OPET
- 5-carboxy-2-oxohex-3-ene-1,6-dioate
- 5-oxopent-3-ene-1,2,5-tricarboxylate
- 1-oxopent-3-ene-1,4,5-tricarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC(C=CC(C([O-])=O)=O)C([O-])=O)([O-])=O" cannot be used as a page name in this wiki.
