Difference between revisions of "CPD-15675"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFONATES SULFONATES] == * common name: ** a sulfonate * Synonym(s): ** an organosulfonate **...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFONATES SULFONATES] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
 +
* smiles:
 +
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* molecular weight:
 +
** 955.803   
 +
* inchi key:
 +
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
 
* common name:
 
* common name:
** a sulfonate
+
** 2-trans-6-trans-tridecadienoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
** an organosulfonate
+
** 2E, 6E-tridecadienoyl-CoA
** a sulfonic acid
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRANS-RXN1HP7-27]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TRANS-RXN1HP7-27]]
+
* [[RXN-14785]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a sulfonate}}
+
* PUBCHEM:
{{#set: common name=an organosulfonate|a sulfonic acid}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
{{#set: consumed by=TRANS-RXN1HP7-27}}
+
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: produced by=TRANS-RXN1HP7-27}}
+
{{#set: molecular weight=955.803    }}
 +
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
 +
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
 +
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
 +
{{#set: produced by=RXN-14785}}

Latest revision as of 17:29, 9 January 2019

Metabolite CPD-15675

  • smiles:
    • CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • molecular weight:
    • 955.803
  • inchi key:
    • InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
  • common name:
    • 2-trans-6-trans-tridecadienoyl-CoA
  • Synonym(s):
    • 2E, 6E-tridecadienoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.