Difference between revisions of "RXN-4210"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CITRULLINE L-CITRULLINE] == * smiles: ** C(NC(N)=O)CCC([N+])C(=O)[O-] * inchi key: ** InChIKe...") |
|||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-4210 RXN-4210] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/1.3.1.21 EC-1.3.1.21] | |
| − | * | + | |
| − | ** | + | |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | + | ** 1 [[CPD-4126]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[CPD-4127]][c] | |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1 5-dehydroavenasterol[c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 isofucosterol[c] |
| − | * [[ | + | |
| − | * [[ | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[CHC_T00006493001_1]] |
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-2541]], plant sterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-2541 PWY-2541] | ||
| + | ** '''12''' reactions found over '''36''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07487 R07487] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-1.3.1.21}} | |
| − | + | {{#set: gene associated=CHC_T00006493001_1}} | |
| − | + | {{#set: in pathway=PWY-2541}} | |
| − | * LIGAND- | + | {{#set: reconstruction category=orthology}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: reconstruction source=orthology-ectocarpus_siliculosus}} |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 17:29, 9 January 2019
Contents
Reaction RXN-4210
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 5-dehydroavenasterol[c] + 1 H+[c] + 1 NADPH[c] => 1 NADP+[c] + 1 isofucosterol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00006493001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-2541, plant sterol biosynthesis: PWY-2541
- 12 reactions found over 36 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
External links
- LIGAND-RXN:
