Difference between revisions of "RXN-12280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14780 CPD-14780] == * smiles: ** C(O)C1(OC(C(C(C1O)O)O)=O) * inchi key: ** InChIKey=PHOQVHQ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12280 RXN-12280] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12280 RXN-12280] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/3.2.1.68 EC-3.2.1.68] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | * [[ | + | ** 1 [[Branched-Unphos-Amylopectin-Tails]][c] '''+''' n [[WATER]][c] '''=>''' n [[Linear-Malto-Oligosaccharides]][c] '''+''' 1 [[CPD-7043]][c] |
− | == | + | * With common name(s): |
+ | ** 1 an exposed unphosphorylated, (α-1,6)-branched malto-oligosaccharide tail on amylopectin[c] '''+''' n H2O[c] '''=>''' n a linear malto-oligosaccharide[c] '''+''' 1 amylopectin[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009540001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6724]], starch degradation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6724 PWY-6724] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.2.1.68}} | |
− | + | {{#set: gene associated=CHC_T00009540001_1}} | |
− | + | {{#set: in pathway=PWY-6724}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 17:39, 23 May 2018
Contents
Reaction RXN-12280
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Branched-Unphos-Amylopectin-Tails[c] + n WATER[c] => n Linear-Malto-Oligosaccharides[c] + 1 CPD-7043[c]
- With common name(s):
- 1 an exposed unphosphorylated, (α-1,6)-branched malto-oligosaccharide tail on amylopectin[c] + n H2O[c] => n a linear malto-oligosaccharide[c] + 1 amylopectin[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009540001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria