|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=OROPRIBTRANS-RXN OROPRIBTRANS-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15839 CPD-15839] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.4.2.10 EC-2.4.2.10] | + | ** 396.612 |
| + | * inchi key: |
| + | ** InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N |
| + | * common name: |
| + | ** δ-tocotrienol |
| * Synonym(s): | | * Synonym(s): |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-14919]] |
− | ** 1 [[OROTIDINE-5-PHOSPHATE]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[PRPP]][c] '''+''' 1 [[OROTATE]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 orotidine 5'-phosphate[c] '''+''' 1 diphosphate[c] '''<=>''' 1 5-phospho-α-D-ribose 1-diphosphate[c] '''+''' 1 orotate[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[CHC_T00002698001_1]] | + | |
− | ** [[pantograph]]-[[galdieria.sulphuraria]]
| + | |
− | ** [[pantograph]]-[[a.taliana]]
| + | |
− | == Pathways == | + | |
− | * [[PWY-7790]], UMP biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7790 PWY-7790]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-7791]], UMP biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7791 PWY-7791]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | * [[PWY-5686]], UMP biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5686 PWY-5686]
| + | |
− | ** '''5''' reactions found over '''6''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[galdieria.sulphuraria]]
| + | |
− | *** [[a.taliana]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CHEBI: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10380 10380] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=33276 33276] |
− | * LIGAND-RXN: | + | * METABOLIGHTS : MTBLC33276 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R01870 R01870] | + | * PUBCHEM: |
− | * UNIPROT:
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282350 5282350] |
− | ** [http://www.uniprot.org/uniprot/P08309 P08309] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/P11172 P11172]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C14156 C14156] |
− | ** [http://www.uniprot.org/uniprot/P18132 P18132]
| + | * HMDB : HMDB30008 |
− | ** [http://www.uniprot.org/uniprot/P77889 P77889] | + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC1(C)(OC2(C(CC1)=CC(=CC=2C)O)))C)C)C}} |
− | ** [http://www.uniprot.org/uniprot/P0A5U0 P0A5U0] | + | {{#set: molecular weight=396.612 }} |
− | ** [http://www.uniprot.org/uniprot/Q9PIR1 Q9PIR1] | + | {{#set: inchi key=InChIKey=ODADKLYLWWCHNB-LDYBVBFYSA-N}} |
− | ** [http://www.uniprot.org/uniprot/O67742 O67742]
| + | {{#set: common name=δ-tocotrienol}} |
− | ** [http://www.uniprot.org/uniprot/O58855 O58855]
| + | {{#set: consumed by=RXN-14919}} |
− | ** [http://www.uniprot.org/uniprot/Q9Z7U6 Q9Z7U6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Y9D8 Q9Y9D8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56814 P56814]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58509 Q58509]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28533 O28533]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CGM8 Q9CGM8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P25972 P25972]
| + | |
− | ** [http://www.uniprot.org/uniprot/O27888 O27888]
| + | |
− | ** [http://www.uniprot.org/uniprot/P65915 P65915]
| + | |
− | ** [http://www.uniprot.org/uniprot/P46534 P46534]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43855 P43855]
| + | |
− | ** [http://www.uniprot.org/uniprot/P31754 P31754]
| + | |
− | ** [http://www.uniprot.org/uniprot/P18904 P18904]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q01637 Q01637]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09556 P09556]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21846 P21846]
| + | |
− | ** [http://www.uniprot.org/uniprot/P35788 P35788]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08870 P08870]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q18516 Q18516]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q45918 Q45918]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42586 Q42586]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41923 P41923]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q55574 Q55574]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42942 Q42942]
| + | |
− | ** [http://www.uniprot.org/uniprot/O76139 O76139]
| + | |
− | ** [http://www.uniprot.org/uniprot/O61790 O61790]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X8R7 Q9X8R7]
| + | |
− | ** [http://www.uniprot.org/uniprot/O94331 O94331]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30402 P30402]
| + | |
− | ** [http://www.uniprot.org/uniprot/P13298 P13298]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A7E3 P0A7E3]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: ec number=EC-2.4.2.10}} | + | |
− | {{#set: gene associated=CHC_T00002698001_1}} | + | |
− | {{#set: in pathway=PWY-7790|PWY-7791|PWY-5686}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=galdieria.sulphuraria|a.taliana}}
| + | |