Difference between revisions of "CHC T00008097001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE SINAPATE] == * smiles: ** COC1(C=C(C=C(OC)C(O)=1)C=CC([O-])=O) * inchi key: ** InChIKe...") |
|||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00008097001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[AICARSYN-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[RXN- | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | == | + | * Reaction: [[AMPSYN-RXN]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7219]] | ||
+ | * [[PWY-7234]] | ||
+ | * [[PWY-6124]] | ||
+ | * [[PWY-6123]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=AICARSYN-RXN|AMPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-7219|PWY-7234|PWY-6124|PWY-6123}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 17:26, 9 January 2019
Gene CHC_T00008097001_1
- Synonym(s):
Reactions associated
- Reaction: AICARSYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: AMPSYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus