Difference between revisions of "CPD-9896"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00009158001 == * left end position: ** 288064 * transcription direction: ** NEGATIVE * right end position: ** 289974 * centisome position: ** 24...")
 
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00009158001 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9896 CPD-9896] ==
* left end position:
+
* smiles:
** 288064
+
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C
* transcription direction:
+
* molecular weight:
** NEGATIVE
+
** 766.178   
* right end position:
+
* inchi key:
** 289974
+
** InChIKey=FMSCZYMOUYOENK-OPSRSWOASA-M
* centisome position:
+
* common name:
** 24.572256   
+
** 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
 +
** 3-nonaprenyl-4,5-dihydroxybenzoate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
+
* [[RXN-9281]]
** original_genome
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-5172]]
+
* [[P23-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=288064}}
+
* CHEBI:
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62789 62789]
{{#set: right end position=289974}}
+
* PUBCHEM:
{{#set: centisome position=24.572256    }}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738024 54738024]
{{#set: reaction associated=ATP-CITRATE-PRO-S--LYASE-RXN}}
+
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C}}
{{#set: pathway associated=PWY-5172|P23-PWY}}
+
{{#set: molecular weight=766.178    }}
 +
{{#set: inchi key=InChIKey=FMSCZYMOUYOENK-OPSRSWOASA-M}}
 +
{{#set: common name=3,4-dihydroxy-5-all-trans-nonaprenylbenzoate}}
 +
{{#set: common name=3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-nonaprenyl-4,5-dihydroxybenzoate}}
 +
{{#set: consumed by=RXN-9281}}

Latest revision as of 18:34, 9 January 2019

Metabolite CPD-9896

  • smiles:
    • CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C
  • molecular weight:
    • 766.178
  • inchi key:
    • InChIKey=FMSCZYMOUYOENK-OPSRSWOASA-M
  • common name:
    • 3,4-dihydroxy-5-all-trans-nonaprenylbenzoate
  • Synonym(s):
    • 3-(3,7,11,15,19,23-nonamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
    • 3-nonaprenyl-4,5-dihydroxybenzoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.