Difference between revisions of "CHC T00004301001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...") |
(Created page with "Category:Gene == Gene CHC_T00004301001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5462 ** Source: orthology-ectocarpus_siliculosus == Pathways...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00004301001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN0-5462]] |
− | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN0-5462}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 16:40, 23 May 2018
Gene CHC_T00004301001_1
- Synonym(s):
Reactions associated
- Reaction: RXN0-5462
- Source: orthology-ectocarpus_siliculosus