Difference between revisions of "CHC T00004301001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...")
 
(Created page with "Category:Gene == Gene CHC_T00004301001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5462 ** Source: orthology-ectocarpus_siliculosus == Pathways...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
+
== Gene CHC_T00004301001_1 ==
* smiles:
+
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
+
* inchi key:
+
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
+
* common name:
+
** melibionate
+
* molecular weight:
+
** 357.291   
+
 
* Synonym(s):
 
* Synonym(s):
** melibionic acid
 
** 6-O-α-D-galactopyranosyl-D-gluconic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17754]]
+
* Reaction: [[RXN0-5462]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN0-5462}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
+
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
+
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
+
{{#set: common name=melibionate}}
+
{{#set: molecular weight=357.291    }}
+
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
+
{{#set: consumed by=RXN-17754}}
+

Latest revision as of 16:40, 23 May 2018

Gene CHC_T00004301001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links