Difference between revisions of "RXN-9361"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9894 CPD-9894] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9361 RXN-9361] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9894 CPD-9894] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9361 RXN-9361] ==
−
* smiles:
+
* direction:
−
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZTGCMYPRIIAXFD-LHSBZCSKSA-M
+
** [http://enzyme.expasy.org/EC/2.1.1.163 EC-2.1.1.163]
−
* common name:
+
−
** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
+
−
* molecular weight:
+
−
** 698.06   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(3,7,11,15,19,23-octamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid
 
−
** 3-octaprenyl-4,5-dihydroxybenzoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-9280]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[CPD-12119]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-12127]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 S-adenosyl-L-methionine[c] '''+''' 1 demethylmenaquinol-10[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 menaquinol-10[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000517001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00005416001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00001339001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00000214001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-5890]], menaquinol-10 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5890 PWY-5890]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54740337 54740337]
+
{{#set: ec number=EC-2.1.1.163}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00000517001_1|CHC_T00005416001_1|CHC_T00001339001_1|CHC_T00000214001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84452 84452]
+
{{#set: in pathway=PWY-5890}}
−
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O-])=O)=C1)O)O))C)C)C)C)C)C)C)C}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=ZTGCMYPRIIAXFD-LHSBZCSKSA-M}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: common name=3,4-dihydroxy-5-all-trans-octaprenylbenzoate}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=698.06    }}
+
−
{{#set: common name=3-(3,7,11,15,19,23-octamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4,5-dihydroxy-benzoic acid|3-octaprenyl-4,5-dihydroxybenzoate}}
+
−
{{#set: consumed by=RXN-9280}}
+

Latest revision as of 17:40, 23 May 2018

Reaction RXN-9361

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5890, menaquinol-10 biosynthesis: PWY-5890
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-9361&oldid=17829"