Difference between revisions of "TRANS-RXN1HP7-1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-1 TRANS-RXN1HP7-1] == * direction: ** LEFT-TO-RIGHT * common name: ** TRANS-RXN1HP7-1...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-558 CPD-558] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN1HP7-1 TRANS-RXN1HP7-1] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I
+
 
* common name:
 
* common name:
−
** pimeloyl-CoA
+
** TRANS-RXN1HP7-1
−
* molecular weight:
+
−
** 904.649   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6-carboxyhexanoyl-CoA
 
−
** pimelyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[7KAPSYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[MG+2]][e] '''+''' 1.0 [[PROTON]][e] '''=>''' 1.0 [[PROTON]][c] '''+''' 1.0 [[MG+2]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 Mg2+[e] '''+''' 1.0 H+[e] '''=>''' 1.0 H+[c] '''+''' 1.0 Mg2+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00004267001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266589 45266589]
+
{{#set: common name=TRANS-RXN1HP7-1}}
−
* CHEBI:
+
{{#set: gene associated=CHC_T00004267001_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57360 57360]
+
{{#set: in pathway=}}
−
* BIGG : pmcoa
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01063 C01063]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCCCC([O-])=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LYCRXMTYUZDUGA-UYRKPTJQSA-I}}
+
−
{{#set: common name=pimeloyl-CoA}}
+
−
{{#set: molecular weight=904.649    }}
+
−
{{#set: common name=6-carboxyhexanoyl-CoA|pimelyl-CoA}}
+
−
{{#set: consumed by=7KAPSYN-RXN}}
+

Latest revision as of 17:43, 23 May 2018

Reaction TRANS-RXN1HP7-1

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • TRANS-RXN1HP7-1
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Mg2+[e] + 1.0 H+[e] => 1.0 H+[c] + 1.0 Mg2+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TRANS-RXN1HP7-1&oldid=17986"