Difference between revisions of "THREONINE--TRNA-LIGASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE--TRNA-LIGASE-RXN THREONINE--TRNA-LIGASE-RXN] == * direction: ** LEFT-TO-RIGHT * common na...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THREONINE--TRNA-LIGASE-RXN THREONINE--TRNA-LIGASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** threonine--tRNA ligase, cytoplasmic |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.1.1.3 EC-6.1.1.3] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[ATP]][c] '''+''' 1 [[THR]][c] '''+''' 1 [[THR-tRNAs]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[Charged-THR-tRNAs]][c] '''+''' 1 [[AMP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 ATP[c] '''+''' 1 L-threonine[c] '''+''' 1 a tRNAthr[c] '''=>''' 1 diphosphate[c] '''+''' 1 an L-threonyl-[tRNAthr][c] '''+''' 1 AMP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[CHC_T00009393001_1]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | * Gene: [[CHC_T00008771001_1]] |
− | == | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | * [[ | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
− | * [[ | + | * Gene: [[CHC_T00008771001]] |
− | * [[ | + | ** Source: [[annotation-original_genome]] |
− | * [[ | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] |
− | * [[ | + | ** '''21''' reactions found over '''21''' reactions in the full pathway |
− | * [[ | + | == Reconstruction information == |
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24624 24624] |
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03663 R03663] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/O83809 O83809] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9JVA3 Q9JVA3] |
− | * | + | ** [http://www.uniprot.org/uniprot/P56071 P56071] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O58430 O58430] |
− | * | + | ** [http://www.uniprot.org/uniprot/P47615 P47615] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O05947 O05947] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PIS3 Q9PIS3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O67583 O67583] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O27504 O27504] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O51662 O51662] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9ZMV3 Q9ZMV3] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9Z7A0 Q9Z7A0] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9WZJ9 Q9WZJ9] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CED2 Q9CED2] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P43014 P43014] |
+ | ** [http://www.uniprot.org/uniprot/P46244 P46244] | ||
+ | ** [http://www.uniprot.org/uniprot/P75225 P75225] | ||
+ | ** [http://www.uniprot.org/uniprot/Q48989 Q48989] | ||
+ | ** [http://www.uniprot.org/uniprot/P0A8M3 P0A8M3] | ||
+ | ** [http://www.uniprot.org/uniprot/O04630 O04630] | ||
+ | ** [http://www.uniprot.org/uniprot/P18255 P18255] | ||
+ | ** [http://www.uniprot.org/uniprot/P18256 P18256] | ||
+ | ** [http://www.uniprot.org/uniprot/P04801 P04801] | ||
+ | ** [http://www.uniprot.org/uniprot/P07236 P07236] | ||
+ | ** [http://www.uniprot.org/uniprot/P26639 P26639] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=threonine--tRNA ligase, cytoplasmic}} | ||
+ | {{#set: ec number=EC-6.1.1.3}} | ||
+ | {{#set: gene associated=CHC_T00009393001_1|CHC_T00008771001_1|CHC_T00008771001}} | ||
+ | {{#set: in pathway=TRNA-CHARGING-PWY}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus|orthology-galdieria.sulphuraria}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Revision as of 16:43, 23 May 2018
Contents
Reaction THREONINE--TRNA-LIGASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- threonine--tRNA ligase, cytoplasmic
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 ATP[c] + 1 L-threonine[c] + 1 a tRNAthr[c] => 1 diphosphate[c] + 1 an L-threonyl-[tRNAthr][c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009393001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00008771001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00008771001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
Pathways
- TRNA-CHARGING-PWY, tRNA charging: TRNA-CHARGING-PWY
- 21 reactions found over 21 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: